C31H48O2S2 — CID 22247331
2,6-ditert-butyl-3-[(2,4-ditert-butyl-3-hydroxyphenyl)disulfanyl]-4-propan-2-ylphenol (PubChem CID 22247331) has the molecular formula C31H48O2S2 and a molecular weight of 516.86 g/mol. Its IUPAC name is 2,6-ditert-butyl-3-[(2,4-ditert-butyl-3-hydroxyphenyl)disulfanyl]-4-propan-2-ylphenol.
| Compound Name | 2,6-ditert-butyl-3-[(2,4-ditert-butyl-3-hydroxyphenyl)disulfanyl]-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 22247331 |
| Molecular Formula | C31H48O2S2 |
| Molecular Weight | 516.86 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 2,6-ditert-butyl-3-[(2,4-ditert-butyl-3-hydroxyphenyl)disulfanyl]-4-propan-2-ylphenol |
| SMILES | CC(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1SSc1ccc(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C31H48O2S2/c1-18(2)19-17-21(29(6,7)8)26(33)24(31(12,13)14)27(19)35-34-22-16-15-20(28(3,4)5)25(32)23(22)30(9,10)11/h15-18,32-33H,1-14H3 |
| InChIKey | WSLBNLFCWWLNAW-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.86 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|