About 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one
3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one (PubChem CID 22447342) has the molecular formula C15H23BrO3S
and a molecular weight of 363.32 g/mol. Its IUPAC name is 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one.
Molecular Properties
| Compound Name | 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one |
| PubChem CID | 22447342 |
| Molecular Formula | C15H23BrO3S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one |
| SMILES | CCC(=O)C(C)SCc1ccco1.CCC(Br)C(C)=O |
| InChI | InChI=1S/C10H14O2S.C5H9BrO/c1-3-10(11)8(2)13-7-9-5-4-6-12-9;1-3-5(6)4(2)7/h4-6,8H,3,7H2,1-2H3;5H,3H2,1-2H3 |
| InChIKey | KZPDLQIEPAVXLF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one?
The IUPAC name of 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one (CID 22447342) is 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one.
What is the SMILES notation for 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one?
The canonical SMILES for 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one is CCC(=O)C(C)SCc1ccco1.CCC(Br)C(C)=O.
What is the InChIKey of 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one?
The InChIKey is KZPDLQIEPAVXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S.C5H9BrO/c1-3-10(11)8(2)13-7-9-5-4-6-12-9;1-3-5(6)4(2)7/h4-6,8H,3,7H2,1-2H3;5H,3H2,1-2H3.
What are the key properties of 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one?
3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one has a molecular weight of 363.32 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopentan-2-one;2-(furan-2-ylmethylsulfanyl)pentan-3-one is sourced from PubChem (CID 22447342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).