About trifluoromethanolate;tris(dimethylamino)sulfanium
trifluoromethanolate;tris(dimethylamino)sulfanium (PubChem CID 22448444) has the molecular formula C7H18F3N3OS
and a molecular weight of 249.30 g/mol. Its IUPAC name is trifluoromethanolate;tris(dimethylamino)sulfanium.
Molecular Properties
| Compound Name | trifluoromethanolate;tris(dimethylamino)sulfanium |
| PubChem CID | 22448444 |
| Molecular Formula | C7H18F3N3OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | trifluoromethanolate;tris(dimethylamino)sulfanium |
| SMILES | CN(C)[S+](N(C)C)N(C)C.[O-]C(F)(F)F |
| InChI | InChI=1S/C6H18N3S.CF3O/c1-7(2)10(8(3)4)9(5)6;2-1(3,4)5/h1-6H3;/q+1;-1 |
| InChIKey | QSTILQJNONMZOZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanolate;tris(dimethylamino)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanolate;tris(dimethylamino)sulfanium?
The IUPAC name of trifluoromethanolate;tris(dimethylamino)sulfanium (CID 22448444) is trifluoromethanolate;tris(dimethylamino)sulfanium.
What is the SMILES notation for trifluoromethanolate;tris(dimethylamino)sulfanium?
The canonical SMILES for trifluoromethanolate;tris(dimethylamino)sulfanium is CN(C)[S+](N(C)C)N(C)C.[O-]C(F)(F)F.
What is the InChIKey of trifluoromethanolate;tris(dimethylamino)sulfanium?
The InChIKey is QSTILQJNONMZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N3S.CF3O/c1-7(2)10(8(3)4)9(5)6;2-1(3,4)5/h1-6H3;/q+1;-1.
What are the key properties of trifluoromethanolate;tris(dimethylamino)sulfanium?
trifluoromethanolate;tris(dimethylamino)sulfanium has a molecular weight of 249.30 g/mol, XLogP of -0.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanolate;tris(dimethylamino)sulfanium is sourced from PubChem (CID 22448444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).