C27H30N4O5S — CID 22456123
2-[3-[4-[(3,5-dimethylphenyl)methoxy]phenyl]-2-oxo-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]pyrrolidin-1-yl]-N-hydroxypropanamide (PubChem CID 22456123) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is 2-[3-[4-[(3,5-dimethylphenyl)methoxy]phenyl]-2-oxo-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]pyrrolidin-1-yl]-N-hydroxypropanamide.
| Compound Name | 2-[3-[4-[(3,5-dimethylphenyl)methoxy]phenyl]-2-oxo-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]pyrrolidin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 22456123 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[3-[4-[(3,5-dimethylphenyl)methoxy]phenyl]-2-oxo-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]pyrrolidin-1-yl]-N-hydroxypropanamide |
| SMILES | Cc1cc(C)cc(COc2ccc(C3(CC(=O)Nc4nccs4)CCN(C(C)C(=O)NO)C3=O)cc2)c1 |
| InChI | InChI=1S/C27H30N4O5S/c1-17-12-18(2)14-20(13-17)16-36-22-6-4-21(5-7-22)27(15-23(32)29-26-28-9-11-37-26)8-10-31(25(27)34)19(3)24(33)30-35/h4-7,9,11-14,19,35H,8,10,15-16H2,1-3H3,(H,30,33)(H,28,29,32) |
| InChIKey | SYTRRYMFLBDDAA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|