C23H30N6O3S — CID 22460096
(E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(2-pyrrolidin-1-ylethylsulfamoyl)anilino]phenyl]prop-2-enamide (PubChem CID 22460096) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(2-pyrrolidin-1-ylethylsulfamoyl)anilino]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(2-pyrrolidin-1-ylethylsulfamoyl)anilino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 22460096 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-(2-pyrrolidin-1-ylethylsulfamoyl)anilino]phenyl]prop-2-enamide |
| SMILES | C/C(=C\c1ccc(Nc2ccc(S(=O)(=O)NCCN3CCCC3)cc2)cc1)C(=O)N=C(N)N |
| InChI | InChI=1S/C23H30N6O3S/c1-17(22(30)28-23(24)25)16-18-4-6-19(7-5-18)27-20-8-10-21(11-9-20)33(31,32)26-12-15-29-13-2-3-14-29/h4-11,16,26-27H,2-3,12-15H2,1H3,(H4,24,25,28,30)/b17-16+ |
| InChIKey | YTNSEEPQLQBTIW-WUKNDPDISA-N |
| XLogP | 2.01 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|