C16H8Br2F8O2 — CID 22467799
1-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-[4-(2-bromo-1,1,2,2-tetrafluoroethoxy)phenyl]benzene (PubChem CID 22467799) has the molecular formula C16H8Br2F8O2 and a molecular weight of 544.03 g/mol. Its IUPAC name is 1-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-[4-(2-bromo-1,1,2,2-tetrafluoroethoxy)phenyl]benzene.
| Compound Name | 1-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-[4-(2-bromo-1,1,2,2-tetrafluoroethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 22467799 |
| Molecular Formula | C16H8Br2F8O2 |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 541.88 |
| IUPAC Name | 1-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-[4-(2-bromo-1,1,2,2-tetrafluoroethoxy)phenyl]benzene |
| SMILES | FC(F)(Br)C(F)(F)Oc1ccc(-c2ccc(OC(F)(F)C(F)(F)Br)cc2)cc1 |
| InChI | InChI=1S/C16H8Br2F8O2/c17-13(19,20)15(23,24)27-11-5-1-9(2-6-11)10-3-7-12(8-4-10)28-16(25,26)14(18,21)22/h1-8H |
| InChIKey | VYJVUJGDOORPCC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|