C22H16F3NO3 — CID 22476883
(2,3,6-trifluorophenyl) 3-methoxy-10-methyl-1H-acridine-9-carboxylate (PubChem CID 22476883) has the molecular formula C22H16F3NO3 and a molecular weight of 399.37 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl) 3-methoxy-10-methyl-1H-acridine-9-carboxylate.
| Compound Name | (2,3,6-trifluorophenyl) 3-methoxy-10-methyl-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 22476883 |
| Molecular Formula | C22H16F3NO3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2,3,6-trifluorophenyl) 3-methoxy-10-methyl-1H-acridine-9-carboxylate |
| SMILES | COC1=CCC2=C(C(=O)Oc3c(F)ccc(F)c3F)c3ccccc3N(C)C2=C1 |
| InChI | InChI=1S/C22H16F3NO3/c1-26-17-6-4-3-5-13(17)19(14-8-7-12(28-2)11-18(14)26)22(27)29-21-16(24)10-9-15(23)20(21)25/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | IQNNPLHEURIWLG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|