C25H30N4O5 — CID 22502860
N-[[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]methyl]-4-methoxyaniline;oxalic acid (PubChem CID 22502860) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]methyl]-4-methoxyaniline;oxalic acid.
| Compound Name | N-[[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]methyl]-4-methoxyaniline;oxalic acid |
|---|---|
| PubChem CID | 22502860 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]methyl]-4-methoxyaniline;oxalic acid |
| SMILES | CCN1CCN(c2nc(CNc3ccc(OC)cc3)cc3ccccc23)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H28N4O.C2H2O4/c1-3-26-12-14-27(15-13-26)23-22-7-5-4-6-18(22)16-20(25-23)17-24-19-8-10-21(28-2)11-9-19;3-1(4)2(5)6/h4-11,16,24H,3,12-15,17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | HAVQJMWFLQYAOA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|