C13H22N2OS2 — CID 22507210
1-tert-butyl-3-(1-hydroxy-4-thiophen-3-ylbutan-2-yl)thiourea (PubChem CID 22507210) has the molecular formula C13H22N2OS2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 1-tert-butyl-3-(1-hydroxy-4-thiophen-3-ylbutan-2-yl)thiourea.
| Compound Name | 1-tert-butyl-3-(1-hydroxy-4-thiophen-3-ylbutan-2-yl)thiourea |
|---|---|
| PubChem CID | 22507210 |
| Molecular Formula | C13H22N2OS2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-tert-butyl-3-(1-hydroxy-4-thiophen-3-ylbutan-2-yl)thiourea |
| SMILES | CC(C)(C)NC(=S)NC(CO)CCc1ccsc1 |
| InChI | InChI=1S/C13H22N2OS2/c1-13(2,3)15-12(17)14-11(8-16)5-4-10-6-7-18-9-10/h6-7,9,11,16H,4-5,8H2,1-3H3,(H2,14,15,17) |
| InChIKey | BUQCJJMXJCHWQM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|