C15H18F4O2 — CID 2250954
(5R)-6,6,7,7-tetrafluoro-5-hydroxy-2,2-dimethyl-5-phenylheptan-3-one (PubChem CID 2250954) has the molecular formula C15H18F4O2 and a molecular weight of 306.30 g/mol. Its IUPAC name is (5R)-6,6,7,7-tetrafluoro-5-hydroxy-2,2-dimethyl-5-phenylheptan-3-one.
| Compound Name | (5R)-6,6,7,7-tetrafluoro-5-hydroxy-2,2-dimethyl-5-phenylheptan-3-one |
|---|---|
| PubChem CID | 2250954 |
| Molecular Formula | C15H18F4O2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (5R)-6,6,7,7-tetrafluoro-5-hydroxy-2,2-dimethyl-5-phenylheptan-3-one |
| SMILES | CC(C)(C)C(=O)C[C@@](O)(c1ccccc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H18F4O2/c1-13(2,3)11(20)9-14(21,15(18,19)12(16)17)10-7-5-4-6-8-10/h4-8,12,21H,9H2,1-3H3/t14-/m1/s1 |
| InChIKey | WWIOLTWSDLMDMH-CQSZACIVSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|