C18H17N2O6S- — CID 2251365
4-[[4-(methoxycarbonylamino)phenyl]sulfonyl-prop-2-enylamino]benzoate (PubChem CID 2251365) has the molecular formula C18H17N2O6S- and a molecular weight of 389.41 g/mol. Its IUPAC name is 4-[[4-(methoxycarbonylamino)phenyl]sulfonyl-prop-2-enylamino]benzoate.
| Compound Name | 4-[[4-(methoxycarbonylamino)phenyl]sulfonyl-prop-2-enylamino]benzoate |
|---|---|
| PubChem CID | 2251365 |
| Molecular Formula | C18H17N2O6S- |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 4-[[4-(methoxycarbonylamino)phenyl]sulfonyl-prop-2-enylamino]benzoate |
| SMILES | C=CCN(c1ccc(C(=O)[O-])cc1)S(=O)(=O)c1ccc(NC(=O)OC)cc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-3-12-20(15-8-4-13(5-9-15)17(21)22)27(24,25)16-10-6-14(7-11-16)19-18(23)26-2/h3-11H,1,12H2,2H3,(H,19,23)(H,21,22)/p-1 |
| InChIKey | NOYINRAGSKXRBR-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|