C19H29N5O2 — CID 22514484
N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide (PubChem CID 22514484) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 22514484 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)Cn1nc(C)n2cccc2c1=O |
| InChI | InChI=1S/C19H29N5O2/c1-3-16-8-4-5-11-22(16)12-7-10-20-18(25)14-24-19(26)17-9-6-13-23(17)15(2)21-24/h6,9,13,16H,3-5,7-8,10-12,14H2,1-2H3,(H,20,25) |
| InChIKey | BLIIJCNERCYPSJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|