C21H21NO4 — CID 22551523
3-(3,5-dimethoxyanilino)-4-(4-propan-2-ylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 22551523) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-(3,5-dimethoxyanilino)-4-(4-propan-2-ylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3,5-dimethoxyanilino)-4-(4-propan-2-ylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22551523 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-(3,5-dimethoxyanilino)-4-(4-propan-2-ylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | COc1cc(Nc2c(-c3ccc(C(C)C)cc3)c(=O)c2=O)cc(OC)c1 |
| InChI | InChI=1S/C21H21NO4/c1-12(2)13-5-7-14(8-6-13)18-19(21(24)20(18)23)22-15-9-16(25-3)11-17(10-15)26-4/h5-12,22H,1-4H3 |
| InChIKey | AUASYJHOTWPVMD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|