C18H16N4O3S2 — CID 22552235
N-(3,5-dimethoxyphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide (PubChem CID 22552235) has the molecular formula C18H16N4O3S2 and a molecular weight of 400.49 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22552235 |
| Molecular Formula | C18H16N4O3S2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-(5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
| SMILES | COc1cc(NC(=O)CSc2nncn3c2cc2sccc23)cc(OC)c1 |
| InChI | InChI=1S/C18H16N4O3S2/c1-24-12-5-11(6-13(7-12)25-2)20-17(23)9-27-18-15-8-16-14(3-4-26-16)22(15)10-19-21-18/h3-8,10H,9H2,1-2H3,(H,20,23) |
| InChIKey | CKASQUJCBPQVLO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |