C8H7NO2S — CID 22556504
3-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 22556504) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 3-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | 3-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 22556504 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 3-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | Cc1csc2cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C8H7NO2S/c1-4-3-12-6-2-5(8(10)11)9-7(4)6/h2-3,9H,1H3,(H,10,11) |
| InChIKey | CNIVWXIXRNMAHJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |