C23H21Cl2N3O4S — CID 22557189
8-[2-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 22557189) has the molecular formula C23H21Cl2N3O4S and a molecular weight of 506.41 g/mol. Its IUPAC name is 8-[2-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[2-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 22557189 |
| Molecular Formula | C23H21Cl2N3O4S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 8-[2-[2,3-dichloro-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C=C(C(=O)N1CCC2(CC1)NC(=O)NC2=O)c1ccc(Sc2ccccc2OC)c(Cl)c1Cl |
| InChI | InChI=1S/C23H21Cl2N3O4S/c1-13(20(29)28-11-9-23(10-12-28)21(30)26-22(31)27-23)14-7-8-17(19(25)18(14)24)33-16-6-4-3-5-15(16)32-2/h3-8H,1,9-12H2,2H3,(H2,26,27,30,31) |
| InChIKey | IVYAYZMNUDMVNY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|