C16H11BrCl2O2S — CID 22557205
methyl 2-[4-(2-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoate (PubChem CID 22557205) has the molecular formula C16H11BrCl2O2S and a molecular weight of 418.14 g/mol. Its IUPAC name is methyl 2-[4-(2-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoate.
| Compound Name | methyl 2-[4-(2-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 22557205 |
| Molecular Formula | C16H11BrCl2O2S |
| Molecular Weight | 418.14 g/mol |
| Exact Mass | 415.90 |
| IUPAC Name | methyl 2-[4-(2-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)c1ccc(Sc2ccccc2Br)c(Cl)c1Cl |
| InChI | InChI=1S/C16H11BrCl2O2S/c1-9(16(20)21-2)10-7-8-13(15(19)14(10)18)22-12-6-4-3-5-11(12)17/h3-8H,1H2,2H3 |
| InChIKey | AXVONRMVTHNNCH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.14 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|