C20H25N4OS+ — CID 22563328
[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azanium (PubChem CID 22563328) has the molecular formula C20H25N4OS+ and a molecular weight of 369.51 g/mol. Its IUPAC name is [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azanium.
| Compound Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azanium |
|---|---|
| PubChem CID | 22563328 |
| Molecular Formula | C20H25N4OS+ |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azanium |
| SMILES | C[N+](C)(CCc1csc(-c2ccccc2)n1)CC(=O)N1CCCC1C#N |
| InChI | InChI=1S/C20H25N4OS/c1-24(2,14-19(25)23-11-6-9-18(23)13-21)12-10-17-15-26-20(22-17)16-7-4-3-5-8-16/h3-5,7-8,15,18H,6,9-12,14H2,1-2H3/q+1 |
| InChIKey | CGSHYAMBQYXJOR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|