C21H27N4OS+ — CID 22563480
[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethyl]azanium (PubChem CID 22563480) has the molecular formula C21H27N4OS+ and a molecular weight of 383.54 g/mol. Its IUPAC name is [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethyl]azanium.
| Compound Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethyl]azanium |
|---|---|
| PubChem CID | 22563480 |
| Molecular Formula | C21H27N4OS+ |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-dimethyl-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethyl]azanium |
| SMILES | Cc1sc(-c2ccccc2)nc1CC[N+](C)(C)CC(=O)N1CCCC1C#N |
| InChI | InChI=1S/C21H27N4OS/c1-16-19(23-21(27-16)17-8-5-4-6-9-17)11-13-25(2,3)15-20(26)24-12-7-10-18(24)14-22/h4-6,8-9,18H,7,10-13,15H2,1-3H3/q+1 |
| InChIKey | XFPXMINOPYSVBK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|