C21H31N6O4S+ — CID 90135002
[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-dimethyl-[3-(4-pyridin-3-ylimidazol-1-yl)propyl]azanium;methanesulfonic acid (PubChem CID 90135002) has the molecular formula C21H31N6O4S+ and a molecular weight of 463.58 g/mol. Its IUPAC name is [2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-dimethyl-[3-(4-pyridin-3-ylimidazol-1-yl)propyl]azanium;methanesulfonic acid.
| Compound Name | [2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-dimethyl-[3-(4-pyridin-3-ylimidazol-1-yl)propyl]azanium;methanesulfonic acid |
|---|---|
| PubChem CID | 90135002 |
| Molecular Formula | C21H31N6O4S+ |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | [2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-dimethyl-[3-(4-pyridin-3-ylimidazol-1-yl)propyl]azanium;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.C[N+](C)(CCCn1cnc(-c2cccnc2)c1)CC(=O)N1CCC[C@H]1C#N |
| InChI | InChI=1S/C20H27N6O.CH4O3S/c1-26(2,15-20(27)25-10-4-7-18(25)12-21)11-5-9-24-14-19(23-16-24)17-6-3-8-22-13-17;1-5(2,3)4/h3,6,8,13-14,16,18H,4-5,7,9-11,15H2,1-2H3;1H3,(H,2,3,4)/q+1;/t18-;/m0./s1 |
| InChIKey | GWQZSHHCAVZSJX-FERBBOLQSA-N |
| XLogP | 1.43 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|