C19H31N2O6PS — CID 22564937
1-cyclohexylsulfonyl-3-[2-di(propan-2-yloxy)phosphorylphenyl]urea (PubChem CID 22564937) has the molecular formula C19H31N2O6PS and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-3-[2-di(propan-2-yloxy)phosphorylphenyl]urea.
| Compound Name | 1-cyclohexylsulfonyl-3-[2-di(propan-2-yloxy)phosphorylphenyl]urea |
|---|---|
| PubChem CID | 22564937 |
| Molecular Formula | C19H31N2O6PS |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-cyclohexylsulfonyl-3-[2-di(propan-2-yloxy)phosphorylphenyl]urea |
| SMILES | CC(C)OP(=O)(OC(C)C)c1ccccc1NC(=O)NS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H31N2O6PS/c1-14(2)26-28(23,27-15(3)4)18-13-9-8-12-17(18)20-19(22)21-29(24,25)16-10-6-5-7-11-16/h8-9,12-16H,5-7,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | DBVNAXRHKIPADA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|