C15H20FNO5S2 — CID 94783911
(2S)-N-cyclohexylsulfonyl-2-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 94783911) has the molecular formula C15H20FNO5S2 and a molecular weight of 377.46 g/mol. Its IUPAC name is (2S)-N-cyclohexylsulfonyl-2-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | (2S)-N-cyclohexylsulfonyl-2-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 94783911 |
| Molecular Formula | C15H20FNO5S2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (2S)-N-cyclohexylsulfonyl-2-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | C[C@@H](C(=O)NS(=O)(=O)C1CCCCC1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FNO5S2/c1-11(23(19,20)13-9-7-12(16)8-10-13)15(18)17-24(21,22)14-5-3-2-4-6-14/h7-11,14H,2-6H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | DDFSXDJTLAWTII-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |