C26H17N3O7 — CID 22569393
2-[[4-(1-acetyl-2-hydroxy-5-nitroindole-3-carbonyl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 22569393) has the molecular formula C26H17N3O7 and a molecular weight of 483.44 g/mol. Its IUPAC name is 2-[[4-(1-acetyl-2-hydroxy-5-nitroindole-3-carbonyl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(1-acetyl-2-hydroxy-5-nitroindole-3-carbonyl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22569393 |
| Molecular Formula | C26H17N3O7 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-[[4-(1-acetyl-2-hydroxy-5-nitroindole-3-carbonyl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC(=O)n1c(O)c(C(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C26H17N3O7/c1-14(30)28-21-11-10-17(29(35)36)12-20(21)22(26(28)34)23(31)16-8-6-15(7-9-16)13-27-24(32)18-4-2-3-5-19(18)25(27)33/h2-12,34H,13H2,1H3 |
| InChIKey | SXJDLQMBSNUCEX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|