C20H20F2O4 — CID 22575058
4,4-difluoro-4-[4-(4-methoxyphenyl)phenyl]-2-(oxiran-2-ylmethyl)butanoic acid (PubChem CID 22575058) has the molecular formula C20H20F2O4 and a molecular weight of 362.37 g/mol. Its IUPAC name is 4,4-difluoro-4-[4-(4-methoxyphenyl)phenyl]-2-(oxiran-2-ylmethyl)butanoic acid.
| Compound Name | 4,4-difluoro-4-[4-(4-methoxyphenyl)phenyl]-2-(oxiran-2-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 22575058 |
| Molecular Formula | C20H20F2O4 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4,4-difluoro-4-[4-(4-methoxyphenyl)phenyl]-2-(oxiran-2-ylmethyl)butanoic acid |
| SMILES | COc1ccc(-c2ccc(C(F)(F)CC(CC3CO3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H20F2O4/c1-25-17-8-4-14(5-9-17)13-2-6-16(7-3-13)20(21,22)11-15(19(23)24)10-18-12-26-18/h2-9,15,18H,10-12H2,1H3,(H,23,24) |
| InChIKey | IMIOBDHXGIKBIN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|