C16H22O4 — CID 103136041
2-[(4-methoxyphenyl)methyl]-3-(5-methyloxolan-2-yl)propanoic acid (PubChem CID 103136041) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-3-(5-methyloxolan-2-yl)propanoic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-3-(5-methyloxolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 103136041 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-3-(5-methyloxolan-2-yl)propanoic acid |
| SMILES | COc1ccc(CC(CC2CCC(C)O2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H22O4/c1-11-3-6-15(20-11)10-13(16(17)18)9-12-4-7-14(19-2)8-5-12/h4-5,7-8,11,13,15H,3,6,9-10H2,1-2H3,(H,17,18) |
| InChIKey | GKLRKALCXUBSBK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |