C40H44O8 — CID 87306240
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]methylidene]-4-(oxiran-2-yl)-3-(oxiran-2-ylmethyl)butanoic acid (PubChem CID 87306240) has the molecular formula C40H44O8 and a molecular weight of 652.78 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]methylidene]-4-(oxiran-2-yl)-3-(oxiran-2-ylmethyl)butanoic acid.
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]methylidene]-4-(oxiran-2-yl)-3-(oxiran-2-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 87306240 |
| Molecular Formula | C40H44O8 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;2-[[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]methylidene]-4-(oxiran-2-yl)-3-(oxiran-2-ylmethyl)butanoic acid |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC(C)(c1ccc(O)cc1)c1ccc(OC=C(C(=O)O)C(CC2CO2)CC2CO2)cc1 |
| InChI | InChI=1S/C25H28O6.C15H16O2/c1-25(2,17-3-7-19(26)8-4-17)18-5-9-20(10-6-18)31-15-23(24(27)28)16(11-21-13-29-21)12-22-14-30-22;1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,15-16,21-22,26H,11-14H2,1-2H3,(H,27,28);3-10,16-17H,1-2H3 |
| InChIKey | NJKRYDDSOBZATC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|