C29H29ClN4O2S — CID 22589661
3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-phenacylsulfanylquinazolin-4-one (PubChem CID 22589661) has the molecular formula C29H29ClN4O2S and a molecular weight of 533.10 g/mol. Its IUPAC name is 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-phenacylsulfanylquinazolin-4-one.
| Compound Name | 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-phenacylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 22589661 |
| Molecular Formula | C29H29ClN4O2S |
| Molecular Weight | 533.10 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2-phenacylsulfanylquinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CCCN1CCN(c2cccc(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H29ClN4O2S/c30-23-10-6-11-24(20-23)33-18-16-32(17-19-33)14-7-15-34-28(36)25-12-4-5-13-26(25)31-29(34)37-21-27(35)22-8-2-1-3-9-22/h1-6,8-13,20H,7,14-19,21H2 |
| InChIKey | KEFOKDALEDEUJD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.10 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |