C31H33ClN4O2S — CID 46503132
2-[(3-chlorophenyl)methylsulfanyl]-3-pentyl-7-(4-phenylpiperazine-1-carbonyl)quinazolin-4-one (PubChem CID 46503132) has the molecular formula C31H33ClN4O2S and a molecular weight of 561.15 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-3-pentyl-7-(4-phenylpiperazine-1-carbonyl)quinazolin-4-one.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-3-pentyl-7-(4-phenylpiperazine-1-carbonyl)quinazolin-4-one |
|---|---|
| PubChem CID | 46503132 |
| Molecular Formula | C31H33ClN4O2S |
| Molecular Weight | 561.15 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-3-pentyl-7-(4-phenylpiperazine-1-carbonyl)quinazolin-4-one |
| SMILES | CCCCCn1c(SCc2cccc(Cl)c2)nc2cc(C(=O)N3CCN(c4ccccc4)CC3)ccc2c1=O |
| InChI | InChI=1S/C31H33ClN4O2S/c1-2-3-7-15-36-30(38)27-14-13-24(21-28(27)33-31(36)39-22-23-9-8-10-25(32)20-23)29(37)35-18-16-34(17-19-35)26-11-5-4-6-12-26/h4-6,8-14,20-21H,2-3,7,15-19,22H2,1H3 |
| InChIKey | DKQXBACNJIITCB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.15 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|