C29H26ClF3N2O4 — CID 22597966
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid (PubChem CID 22597966) has the molecular formula C29H26ClF3N2O4 and a molecular weight of 558.98 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 22597966 |
| Molecular Formula | C29H26ClF3N2O4 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(=O)CCC3CCN(CC#Cc4cc(F)cc(F)c4F)CC3CC(=O)O)c2c1 |
| InChI | InChI=1S/C29H26ClF3N2O4/c1-39-21-5-6-25-22(14-21)28(23(30)15-34-25)26(36)7-4-17-8-10-35(16-19(17)12-27(37)38)9-2-3-18-11-20(31)13-24(32)29(18)33/h5-6,11,13-15,17,19H,4,7-10,12,16H2,1H3,(H,37,38) |
| InChIKey | UVRJZXZLLMEANF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|