C27H27ClN2O4S — CID 22597874
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid (PubChem CID 22597874) has the molecular formula C27H27ClN2O4S and a molecular weight of 511.04 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 22597874 |
| Molecular Formula | C27H27ClN2O4S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(=O)CCC3CCN(CC#Cc4ccsc4)CC3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H27ClN2O4S/c1-34-21-5-6-24-22(14-21)27(23(28)15-29-24)25(31)7-4-19-8-11-30(16-20(19)13-26(32)33)10-2-3-18-9-12-35-17-18/h5-6,9,12,14-15,17,19-20H,4,7-8,10-11,13,16H2,1H3,(H,32,33) |
| InChIKey | ISKNAABPSFHJDC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|