C19H31ClF2O3Si — CID 22598016
[3-(2-chloroethoxy)-4-(difluoromethoxy)phenyl]methoxy-tri(propan-2-yl)silane (PubChem CID 22598016) has the molecular formula C19H31ClF2O3Si and a molecular weight of 408.99 g/mol. Its IUPAC name is [3-(2-chloroethoxy)-4-(difluoromethoxy)phenyl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [3-(2-chloroethoxy)-4-(difluoromethoxy)phenyl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 22598016 |
| Molecular Formula | C19H31ClF2O3Si |
| Molecular Weight | 408.99 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [3-(2-chloroethoxy)-4-(difluoromethoxy)phenyl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCc1ccc(OC(F)F)c(OCCCl)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H31ClF2O3Si/c1-13(2)26(14(3)4,15(5)6)24-12-16-7-8-17(25-19(21)22)18(11-16)23-10-9-20/h7-8,11,13-15,19H,9-10,12H2,1-6H3 |
| InChIKey | JGALYFJYHAIFEF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.99 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|