C12H21F7O3Si — CID 22600767
triethoxy(4,4,5,5,6,6,6-heptafluorohexyl)silane (PubChem CID 22600767) has the molecular formula C12H21F7O3Si and a molecular weight of 374.37 g/mol. Its IUPAC name is triethoxy(4,4,5,5,6,6,6-heptafluorohexyl)silane.
| Compound Name | triethoxy(4,4,5,5,6,6,6-heptafluorohexyl)silane |
|---|---|
| PubChem CID | 22600767 |
| Molecular Formula | C12H21F7O3Si |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | triethoxy(4,4,5,5,6,6,6-heptafluorohexyl)silane |
| SMILES | CCO[Si](CCCC(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C12H21F7O3Si/c1-4-20-23(21-5-2,22-6-3)9-7-8-10(13,14)11(15,16)12(17,18)19/h4-9H2,1-3H3 |
| InChIKey | YUNPGHMVZKZETP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|