About iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline)
iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) (PubChem CID 22600896) has the molecular formula C32H20F6IrN2+3
and a molecular weight of 738.73 g/mol. Its IUPAC name is iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline).
Molecular Properties
| Compound Name | iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) |
| PubChem CID | 22600896 |
| Molecular Formula | C32H20F6IrN2+3 |
| Molecular Weight | 738.73 g/mol |
| Exact Mass | 739.11 |
| IUPAC Name | iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) |
| SMILES | FC(F)(F)c1ccccc1-c1ccc2ccccc2n1.FC(F)(F)c1ccccc1-c1ccc2ccccc2n1.[Ir+3] |
| InChI | InChI=1S/2C16H10F3N.Ir/c2*17-16(18,19)13-7-3-2-6-12(13)15-10-9-11-5-1-4-8-14(11)20-15;/h2*1-10H;/q;;+3 |
| InChIKey | KCCCJESWSKSNGE-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.73 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline)?
The IUPAC name of iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) (CID 22600896) is iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline).
What is the SMILES notation for iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline)?
The canonical SMILES for iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) is FC(F)(F)c1ccccc1-c1ccc2ccccc2n1.FC(F)(F)c1ccccc1-c1ccc2ccccc2n1.[Ir+3].
What is the InChIKey of iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline)?
The InChIKey is KCCCJESWSKSNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H10F3N.Ir/c2*17-16(18,19)13-7-3-2-6-12(13)15-10-9-11-5-1-4-8-14(11)20-15;/h2*1-10H;/q;;+3.
What are the key properties of iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline)?
iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) has a molecular weight of 738.73 g/mol, XLogP of 9.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium(3+);bis(2-[2-(trifluoromethyl)phenyl]quinoline) is sourced from PubChem (CID 22600896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).