About 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate
5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate (PubChem CID 22601058) has the molecular formula C15H16Cl2N2O4
and a molecular weight of 359.21 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate.
Molecular Properties
| Compound Name | 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate |
| PubChem CID | 22601058 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C)CC(C(=O)OC)=NN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O4/c1-4-23-14(21)15(2)8-11(13(20)22-3)18-19(15)12-6-5-9(16)7-10(12)17/h5-7H,4,8H2,1-3H3 |
| InChIKey | RCRSRRZGQYUMML-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate?
The IUPAC name of 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate (CID 22601058) is 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate.
What is the SMILES notation for 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate?
The canonical SMILES for 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate is CCOC(=O)C1(C)CC(C(=O)OC)=NN1c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate?
The InChIKey is RCRSRRZGQYUMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2O4/c1-4-23-14(21)15(2)8-11(13(20)22-3)18-19(15)12-6-5-9(16)7-10(12)17/h5-7H,4,8H2,1-3H3.
What are the key properties of 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate?
5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate has a molecular weight of 359.21 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 3-O-methyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate is sourced from PubChem (CID 22601058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).