C17H24 — CID 22602468
2,7-dimethyl-4,6-di(propan-2-yl)-1H-indene (PubChem CID 22602468) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,7-dimethyl-4,6-di(propan-2-yl)-1H-indene.
| Compound Name | 2,7-dimethyl-4,6-di(propan-2-yl)-1H-indene |
|---|---|
| PubChem CID | 22602468 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2,7-dimethyl-4,6-di(propan-2-yl)-1H-indene |
| SMILES | CC1=Cc2c(C(C)C)cc(C(C)C)c(C)c2C1 |
| InChI | InChI=1S/C17H24/c1-10(2)14-9-15(11(3)4)17-8-12(5)7-16(17)13(14)6/h8-11H,7H2,1-6H3 |
| InChIKey | HZAKJTOBNISHMI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |