C4BrF8I — CID 22613612
1-bromo-1,1,3,3,3-pentafluoro-2-iodo-2-(trifluoromethyl)propane (PubChem CID 22613612) has the molecular formula C4BrF8I and a molecular weight of 406.84 g/mol. Its IUPAC name is 1-bromo-1,1,3,3,3-pentafluoro-2-iodo-2-(trifluoromethyl)propane.
| Compound Name | 1-bromo-1,1,3,3,3-pentafluoro-2-iodo-2-(trifluoromethyl)propane |
|---|---|
| PubChem CID | 22613612 |
| Molecular Formula | C4BrF8I |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 405.81 |
| IUPAC Name | 1-bromo-1,1,3,3,3-pentafluoro-2-iodo-2-(trifluoromethyl)propane |
| SMILES | FC(F)(F)C(I)(C(F)(F)F)C(F)(F)Br |
| InChI | InChI=1S/C4BrF8I/c5-2(6,7)1(14,3(8,9)10)4(11,12)13 |
| InChIKey | QFUPCQOEAWRBJY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|