C15H26NO+ — CID 2262255
tert-butyl-[2-(2,3,5-trimethylphenoxy)ethyl]azanium (PubChem CID 2262255) has the molecular formula C15H26NO+ and a molecular weight of 236.38 g/mol. Its IUPAC name is tert-butyl-[2-(2,3,5-trimethylphenoxy)ethyl]azanium.
| Compound Name | tert-butyl-[2-(2,3,5-trimethylphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 2262255 |
| Molecular Formula | C15H26NO+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | tert-butyl-[2-(2,3,5-trimethylphenoxy)ethyl]azanium |
| SMILES | Cc1cc(C)c(C)c(OCC[NH2+]C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO/c1-11-9-12(2)13(3)14(10-11)17-8-7-16-15(4,5)6/h9-10,16H,7-8H2,1-6H3/p+1 |
| InChIKey | UHQJTURVQAGYAA-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|