C16H23NO — CID 65257217
2,2-dimethyl-5-(2,3,5-trimethylphenoxy)pentanenitrile (PubChem CID 65257217) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2,3,5-trimethylphenoxy)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(2,3,5-trimethylphenoxy)pentanenitrile |
|---|---|
| PubChem CID | 65257217 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2,2-dimethyl-5-(2,3,5-trimethylphenoxy)pentanenitrile |
| SMILES | Cc1cc(C)c(C)c(OCCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C16H23NO/c1-12-9-13(2)14(3)15(10-12)18-8-6-7-16(4,5)11-17/h9-10H,6-8H2,1-5H3 |
| InChIKey | XYQDKUZISHFJOY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|