C7H13NO — CID 22623666
2,6-dimethylpiperidin-3-one (PubChem CID 22623666) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 2,6-dimethylpiperidin-3-one.
| Compound Name | 2,6-dimethylpiperidin-3-one |
|---|---|
| PubChem CID | 22623666 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2,6-dimethylpiperidin-3-one |
| SMILES | CC1CCC(=O)C(C)N1 |
| InChI | InChI=1S/C7H13NO/c1-5-3-4-7(9)6(2)8-5/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | SZKYJGRAVJWKNC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |