C26H28N4O4S — CID 22626015
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-5-methylthiophen-3-yl]-5-(2,2-dimethylpropylcarbamoyl)benzoic acid (PubChem CID 22626015) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-5-methylthiophen-3-yl]-5-(2,2-dimethylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-5-methylthiophen-3-yl]-5-(2,2-dimethylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 22626015 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-5-methylthiophen-3-yl]-5-(2,2-dimethylpropylcarbamoyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2sc(C)cc2-c2ccc(C(=O)NCC(C)(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H28N4O4S/c1-14-11-19(21(35-14)24(32)30-17-8-5-15(6-9-17)22(27)28)18-10-7-16(12-20(18)25(33)34)23(31)29-13-26(2,3)4/h5-12H,13H2,1-4H3,(H3,27,28)(H,29,31)(H,30,32)(H,33,34) |
| InChIKey | UNFROBVUKRSUOQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|