C14H13N3O6 — CID 22626961
2-(benzoyloxycarbonylamino)-4-(1,3,4-oxadiazol-2-yl)butanoic acid (PubChem CID 22626961) has the molecular formula C14H13N3O6 and a molecular weight of 319.27 g/mol. Its IUPAC name is 2-(benzoyloxycarbonylamino)-4-(1,3,4-oxadiazol-2-yl)butanoic acid.
| Compound Name | 2-(benzoyloxycarbonylamino)-4-(1,3,4-oxadiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 22626961 |
| Molecular Formula | C14H13N3O6 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(benzoyloxycarbonylamino)-4-(1,3,4-oxadiazol-2-yl)butanoic acid |
| SMILES | O=C(NC(CCc1nnco1)C(=O)O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O6/c18-12(19)10(6-7-11-17-15-8-22-11)16-14(21)23-13(20)9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,16,21)(H,18,19) |
| InChIKey | VEZSYKWTTRVGLF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|