C30H21N2O6- — CID 2262917
2-methoxy-5-[(Z)-[1-(3-methylphenyl)-3-naphthalen-1-yl-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate (PubChem CID 2262917) has the molecular formula C30H21N2O6- and a molecular weight of 505.51 g/mol. Its IUPAC name is 2-methoxy-5-[(Z)-[1-(3-methylphenyl)-3-naphthalen-1-yl-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate.
| Compound Name | 2-methoxy-5-[(Z)-[1-(3-methylphenyl)-3-naphthalen-1-yl-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2262917 |
| Molecular Formula | C30H21N2O6- |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 2-methoxy-5-[(Z)-[1-(3-methylphenyl)-3-naphthalen-1-yl-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=C2/C(=O)N(c3cccc(C)c3)C(=O)N(c3cccc4ccccc34)C2=O)cc1C(=O)[O-] |
| InChI | InChI=1S/C30H22N2O6/c1-18-7-5-10-21(15-18)31-27(33)24(17-19-13-14-26(38-2)23(16-19)29(35)36)28(34)32(30(31)37)25-12-6-9-20-8-3-4-11-22(20)25/h3-17H,1-2H3,(H,35,36)/p-1/b24-17- |
| InChIKey | HOYZNQSGPQDQHO-ULJHMMPZSA-M |
| XLogP | 4.10 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|