C37H27BrCl2N2O5 — CID 99664651
(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione (PubChem CID 99664651) has the molecular formula C37H27BrCl2N2O5 and a molecular weight of 730.44 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 99664651 |
| Molecular Formula | C37H27BrCl2N2O5 |
| Molecular Weight | 730.44 g/mol |
| Exact Mass | 728.05 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3cccc(C)c3)C(=O)N(c3cccc4ccccc34)C2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H27BrCl2N2O5/c1-3-46-33-19-23(18-30(38)34(33)47-21-25-14-15-26(39)20-31(25)40)17-29-35(43)41(27-11-6-8-22(2)16-27)37(45)42(36(29)44)32-13-7-10-24-9-4-5-12-28(24)32/h4-20H,3,21H2,1-2H3/b29-17+ |
| InChIKey | SPVNQEBJUZLEKG-STBIYBPSSA-N |
| XLogP | 9.78 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.44 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|