C30H24N2O5 — CID 94849115
(5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione (PubChem CID 94849115) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is (5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 94849115 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (5E)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1-(3-methylphenyl)-3-naphthalen-1-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3cccc(C)c3)C(=O)N(c3cccc4ccccc34)C2=O)ccc1O |
| InChI | InChI=1S/C30H24N2O5/c1-3-37-27-18-20(14-15-26(27)33)17-24-28(34)31(22-11-6-8-19(2)16-22)30(36)32(29(24)35)25-13-7-10-21-9-4-5-12-23(21)25/h4-18,33H,3H2,1-2H3/b24-17+ |
| InChIKey | ASRLZIKKRJULEB-JJIBRWJFSA-N |
| XLogP | 5.84 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|