C18H33F6N — CID 22637418
N-(3-ethylheptyl)-1,1,2,2,3,3-hexafluorononan-1-amine (PubChem CID 22637418) has the molecular formula C18H33F6N and a molecular weight of 377.46 g/mol. Its IUPAC name is N-(3-ethylheptyl)-1,1,2,2,3,3-hexafluorononan-1-amine.
| Compound Name | N-(3-ethylheptyl)-1,1,2,2,3,3-hexafluorononan-1-amine |
|---|---|
| PubChem CID | 22637418 |
| Molecular Formula | C18H33F6N |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-(3-ethylheptyl)-1,1,2,2,3,3-hexafluorononan-1-amine |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NCCC(CC)CCCC |
| InChI | InChI=1S/C18H33F6N/c1-4-7-9-10-13-16(19,20)17(21,22)18(23,24)25-14-12-15(6-3)11-8-5-2/h15,25H,4-14H2,1-3H3 |
| InChIKey | JNIOEOBSFVLVLI-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|