C16H12ClFN2O2 — CID 22646633
2-(4-chloro-2-fluoroanilino)-7-methoxyquinolin-6-ol (PubChem CID 22646633) has the molecular formula C16H12ClFN2O2 and a molecular weight of 318.74 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoroanilino)-7-methoxyquinolin-6-ol.
| Compound Name | 2-(4-chloro-2-fluoroanilino)-7-methoxyquinolin-6-ol |
|---|---|
| PubChem CID | 22646633 |
| Molecular Formula | C16H12ClFN2O2 |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-(4-chloro-2-fluoroanilino)-7-methoxyquinolin-6-ol |
| SMILES | COc1cc2nc(Nc3ccc(Cl)cc3F)ccc2cc1O |
| InChI | InChI=1S/C16H12ClFN2O2/c1-22-15-8-13-9(6-14(15)21)2-5-16(20-13)19-12-4-3-10(17)7-11(12)18/h2-8,21H,1H3,(H,19,20) |
| InChIKey | DNWYMFQUMHVZGY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |