C27H35ClFN3O2 — CID 164899925
N-(3-chloro-4-fluorophenyl)-7-[3-(dibutylamino)propoxy]-6-methoxyquinolin-2-amine (PubChem CID 164899925) has the molecular formula C27H35ClFN3O2 and a molecular weight of 488.05 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-[3-(dibutylamino)propoxy]-6-methoxyquinolin-2-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-[3-(dibutylamino)propoxy]-6-methoxyquinolin-2-amine |
|---|---|
| PubChem CID | 164899925 |
| Molecular Formula | C27H35ClFN3O2 |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-[3-(dibutylamino)propoxy]-6-methoxyquinolin-2-amine |
| SMILES | CCCCN(CCCC)CCCOc1cc2nc(Nc3ccc(F)c(Cl)c3)ccc2cc1OC |
| InChI | InChI=1S/C27H35ClFN3O2/c1-4-6-13-32(14-7-5-2)15-8-16-34-26-19-24-20(17-25(26)33-3)9-12-27(31-24)30-21-10-11-23(29)22(28)18-21/h9-12,17-19H,4-8,13-16H2,1-3H3,(H,30,31) |
| InChIKey | XNDQPLBVYZYSOE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|