C21H14N6O3S — CID 2265342
2-[(R)-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(3-nitrophenyl)methyl]propanedinitrile (PubChem CID 2265342) has the molecular formula C21H14N6O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-[(R)-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(3-nitrophenyl)methyl]propanedinitrile.
| Compound Name | 2-[(R)-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(3-nitrophenyl)methyl]propanedinitrile |
|---|---|
| PubChem CID | 2265342 |
| Molecular Formula | C21H14N6O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-[(R)-[2-(1,3-benzothiazol-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(3-nitrophenyl)methyl]propanedinitrile |
| SMILES | Cc1[nH]n(-c2nc3ccccc3s2)c(=O)c1[C@@H](c1cccc([N+](=O)[O-])c1)C(C#N)C#N |
| InChI | InChI=1S/C21H14N6O3S/c1-12-18(19(14(10-22)11-23)13-5-4-6-15(9-13)27(29)30)20(28)26(25-12)21-24-16-7-2-3-8-17(16)31-21/h2-9,14,19,25H,1H3/t19-/m0/s1 |
| InChIKey | GZJMBZYYIAHSHY-IBGZPJMESA-N |
| XLogP | 3.79 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|