C23H28FN2O3S+ — CID 22663709
[1-ethylsulfonyl-1-[4-(4-fluoro-2-propylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663709) has the molecular formula C23H28FN2O3S+ and a molecular weight of 431.55 g/mol. Its IUPAC name is [1-ethylsulfonyl-1-[4-(4-fluoro-2-propylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-ethylsulfonyl-1-[4-(4-fluoro-2-propylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663709 |
| Molecular Formula | C23H28FN2O3S+ |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [1-ethylsulfonyl-1-[4-(4-fluoro-2-propylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | CCCc1cc(F)ccc1Oc1ccc([N+]2(S(=O)(=O)CC)C=C(CN)C=CC2)cc1 |
| InChI | InChI=1S/C23H28FN2O3S/c1-3-6-19-15-20(24)8-13-23(19)29-22-11-9-21(10-12-22)26(30(27,28)4-2)14-5-7-18(16-25)17-26/h5,7-13,15,17H,3-4,6,14,16,25H2,1-2H3/q+1 |
| InChIKey | QYRIUKAKZPCLKL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|