C27H29N2O4S2+ — CID 22663533
4-[2-[4-[5-(aminomethyl)-1-propylsulfonyl-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione (PubChem CID 22663533) has the molecular formula C27H29N2O4S2+ and a molecular weight of 509.67 g/mol. Its IUPAC name is 4-[2-[4-[5-(aminomethyl)-1-propylsulfonyl-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione.
| Compound Name | 4-[2-[4-[5-(aminomethyl)-1-propylsulfonyl-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 22663533 |
| Molecular Formula | C27H29N2O4S2+ |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[2-[4-[5-(aminomethyl)-1-propylsulfonyl-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione |
| SMILES | CCCS(=O)(=O)[N+]1(c2ccc(Oc3ccccc3OC3=CCC(=S)C=C3)cc2)C=C(CN)C=CC1 |
| InChI | InChI=1S/C27H29N2O4S2/c1-2-18-35(30,31)29(17-5-6-21(19-28)20-29)22-9-11-23(12-10-22)32-26-7-3-4-8-27(26)33-24-13-15-25(34)16-14-24/h3-15,20H,2,16-19,28H2,1H3/q+1 |
| InChIKey | KCJYNTLNRGAXGT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|